C23H31NO — CID 42564070
N-benzyl-2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethanamine (PubChem CID 42564070) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is N-benzyl-2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethanamine.
| Compound Name | N-benzyl-2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethanamine |
|---|---|
| PubChem CID | 42564070 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | N-benzyl-2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethanamine |
| SMILES | CC1(C)C[C@@](CCNCc2ccccc2)(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C23H31NO/c1-22(2)19-23(14-16-25-22,17-20-9-5-3-6-10-20)13-15-24-18-21-11-7-4-8-12-21/h3-12,24H,13-19H2,1-2H3/t23-/m1/s1 |
| InChIKey | UEWIGVOOLPSOOV-HSZRJFAPSA-N |
| XLogP | 4.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|