C24H28NO4- — CID 6970726
2-[2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethylcarbamoyl]benzoate (PubChem CID 6970726) has the molecular formula C24H28NO4- and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethylcarbamoyl]benzoate.
| Compound Name | 2-[2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 6970726 |
| Molecular Formula | C24H28NO4- |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[2-[(4R)-4-benzyl-2,2-dimethyloxan-4-yl]ethylcarbamoyl]benzoate |
| SMILES | CC1(C)C[C@@](CCNC(=O)c2ccccc2C(=O)[O-])(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C24H29NO4/c1-23(2)17-24(13-15-29-23,16-18-8-4-3-5-9-18)12-14-25-21(26)19-10-6-7-11-20(19)22(27)28/h3-11H,12-17H2,1-2H3,(H,25,26)(H,27,28)/p-1/t24-/m1/s1 |
| InChIKey | HKOFUQLUQLQORX-XMMPIXPASA-M |
| XLogP | 2.99 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |