C20H25N3O2 — CID 90653265
N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 90653265) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90653265 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | CC1(C)CC(CCNC(=O)c2cnccn2)(c2ccccc2)CCO1 |
| InChI | InChI=1S/C20H25N3O2/c1-19(2)15-20(9-13-25-19,16-6-4-3-5-7-16)8-10-23-18(24)17-14-21-11-12-22-17/h3-7,11-12,14H,8-10,13,15H2,1-2H3,(H,23,24) |
| InChIKey | KSMHGTXFQPYWIC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |