C28H37N3O3 — CID 144587719
N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-6-[5-(2-methoxyethoxy)cyclohexa-1,5-dien-1-yl]pyrazin-2-amine (PubChem CID 144587719) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-6-[5-(2-methoxyethoxy)cyclohexa-1,5-dien-1-yl]pyrazin-2-amine.
| Compound Name | N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-6-[5-(2-methoxyethoxy)cyclohexa-1,5-dien-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 144587719 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-6-[5-(2-methoxyethoxy)cyclohexa-1,5-dien-1-yl]pyrazin-2-amine |
| SMILES | COCCOC1=CC(c2cncc(NCCC3(c4ccccc4)CCOC(C)(C)C3)n2)=CCC1 |
| InChI | InChI=1S/C28H37N3O3/c1-27(2)21-28(13-15-34-27,23-9-5-4-6-10-23)12-14-30-26-20-29-19-25(31-26)22-8-7-11-24(18-22)33-17-16-32-3/h4-6,8-10,18-20H,7,11-17,21H2,1-3H3,(H,30,31) |
| InChIKey | MVCCJNQEEMIJRM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|