C18H14N2O6-2 — CID 40932229
2-[2-[(2-carboxylatobenzoyl)amino]ethylcarbamoyl]benzoate (PubChem CID 40932229) has the molecular formula C18H14N2O6-2 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[2-[(2-carboxylatobenzoyl)amino]ethylcarbamoyl]benzoate.
| Compound Name | 2-[2-[(2-carboxylatobenzoyl)amino]ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 40932229 |
| Molecular Formula | C18H14N2O6-2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[2-[(2-carboxylatobenzoyl)amino]ethylcarbamoyl]benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)NCCNC(=O)c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C18H16N2O6/c21-15(11-5-1-3-7-13(11)17(23)24)19-9-10-20-16(22)12-6-2-4-8-14(12)18(25)26/h1-8H,9-10H2,(H,19,21)(H,20,22)(H,23,24)(H,25,26)/p-2 |
| InChIKey | VDGWBERLBOLCGW-UHFFFAOYSA-L |
| XLogP | -1.43 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|