C22H33NO3 — CID 4552064
1-(1,3-benzodioxol-5-yl)-N-[2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl]methanimine (PubChem CID 4552064) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl]methanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl]methanimine |
|---|---|
| PubChem CID | 4552064 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl]methanimine |
| SMILES | CC(C)CCC1(CC/N=C/c2ccc3c(c2)OCO3)CCOC(C)(C)C1 |
| InChI | InChI=1S/C22H33NO3/c1-17(2)7-8-22(10-12-26-21(3,4)15-22)9-11-23-14-18-5-6-19-20(13-18)25-16-24-19/h5-6,13-14,17H,7-12,15-16H2,1-4H3/b23-14+ |
| InChIKey | IJZWOXUHBZIEBU-OEAKJJBVSA-N |
| XLogP | 5.24 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|