C37H34O4 — CID 58596356
5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9,9-dipropylfluoren-2-yl]ethenyl]-1,3-benzodioxole (PubChem CID 58596356) has the molecular formula C37H34O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is 5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9,9-dipropylfluoren-2-yl]ethenyl]-1,3-benzodioxole.
| Compound Name | 5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9,9-dipropylfluoren-2-yl]ethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 58596356 |
| Molecular Formula | C37H34O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9,9-dipropylfluoren-2-yl]ethenyl]-1,3-benzodioxole |
| SMILES | CCCC1(CCC)c2cc(/C=C/c3ccc4c(c3)OCO4)ccc2-c2ccc(/C=C/c3ccc4c(c3)OCO4)cc21 |
| InChI | InChI=1S/C37H34O4/c1-3-17-37(18-4-2)31-19-25(5-7-27-11-15-33-35(21-27)40-23-38-33)9-13-29(31)30-14-10-26(20-32(30)37)6-8-28-12-16-34-36(22-28)41-24-39-34/h5-16,19-22H,3-4,17-18,23-24H2,1-2H3/b7-5+,8-6+ |
| InChIKey | BDKJPCZQYSDKEP-KQQUZDAGSA-N |
| XLogP | 9.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|