C26H38NO3+ — CID 2172948
(3,4-dimethoxyphenyl)methyl-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]azanium (PubChem CID 2172948) has the molecular formula C26H38NO3+ and a molecular weight of 412.59 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]azanium |
|---|---|
| PubChem CID | 2172948 |
| Molecular Formula | C26H38NO3+ |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-3-(4-methylphenyl)propyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@H](c2ccc(C)cc2)[C@H]2CCOC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C26H37NO3/c1-19-6-9-21(10-7-19)23(22-13-15-30-26(2,3)17-22)12-14-27-18-20-8-11-24(28-4)25(16-20)29-5/h6-11,16,22-23,27H,12-15,17-18H2,1-5H3/p+1/t22-,23+/m0/s1 |
| InChIKey | JDMQXNFPAAYYAJ-XZOQPEGZSA-O |
| XLogP | 4.45 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|