C24H41NO3 — CID 7093998
(3R)-N-[(3,4-dimethoxyphenyl)methyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine (PubChem CID 7093998) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is (3R)-N-[(3,4-dimethoxyphenyl)methyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine.
| Compound Name | (3R)-N-[(3,4-dimethoxyphenyl)methyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 7093998 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (3R)-N-[(3,4-dimethoxyphenyl)methyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine |
| SMILES | COc1ccc(CNCC[C@@H](CCC(C)C)[C@@H]2CCOC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C24H41NO3/c1-18(2)7-9-20(21-12-14-28-24(3,4)16-21)11-13-25-17-19-8-10-22(26-5)23(15-19)27-6/h8,10,15,18,20-21,25H,7,9,11-14,16-17H2,1-6H3/t20-,21-/m1/s1 |
| InChIKey | GTEPJOQKWIWTCQ-NHCUHLMSSA-N |
| XLogP | 5.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|