C24H39NO — CID 7094770
(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methyl-N-[(E)-3-phenylprop-2-enyl]heptan-1-amine (PubChem CID 7094770) has the molecular formula C24H39NO and a molecular weight of 357.58 g/mol. Its IUPAC name is (3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methyl-N-[(E)-3-phenylprop-2-enyl]heptan-1-amine.
| Compound Name | (3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methyl-N-[(E)-3-phenylprop-2-enyl]heptan-1-amine |
|---|---|
| PubChem CID | 7094770 |
| Molecular Formula | C24H39NO |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | (3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methyl-N-[(E)-3-phenylprop-2-enyl]heptan-1-amine |
| SMILES | CC(C)CC[C@@H](CCNC/C=C/c1ccccc1)[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C24H39NO/c1-20(2)12-13-22(23-15-18-26-24(3,4)19-23)14-17-25-16-8-11-21-9-6-5-7-10-21/h5-11,20,22-23,25H,12-19H2,1-4H3/b11-8+/t22-,23-/m0/s1 |
| InChIKey | KVPNTTYXOXZHSK-GZWJZLGDSA-N |
| XLogP | 5.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|