C23H31ClN2O — CID 40634731
(3R)-4-(2-chlorophenyl)-3-[(4S)-2,2-dimethyloxan-4-yl]-N-(pyridin-3-ylmethyl)butan-1-amine (PubChem CID 40634731) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is (3R)-4-(2-chlorophenyl)-3-[(4S)-2,2-dimethyloxan-4-yl]-N-(pyridin-3-ylmethyl)butan-1-amine.
| Compound Name | (3R)-4-(2-chlorophenyl)-3-[(4S)-2,2-dimethyloxan-4-yl]-N-(pyridin-3-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 40634731 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (3R)-4-(2-chlorophenyl)-3-[(4S)-2,2-dimethyloxan-4-yl]-N-(pyridin-3-ylmethyl)butan-1-amine |
| SMILES | CC1(C)C[C@@H]([C@@H](CCNCc2cccnc2)Cc2ccccc2Cl)CCO1 |
| InChI | InChI=1S/C23H31ClN2O/c1-23(2)15-21(10-13-27-23)19(14-20-7-3-4-8-22(20)24)9-12-26-17-18-6-5-11-25-16-18/h3-8,11,16,19,21,26H,9-10,12-15,17H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | STVWFWWVHLSYSO-FPOVZHCZSA-N |
| XLogP | 5.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|