C20H36NO2+ — CID 7094282
[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(furan-2-ylmethyl)azanium (PubChem CID 7094282) has the molecular formula C20H36NO2+ and a molecular weight of 322.51 g/mol. Its IUPAC name is [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(furan-2-ylmethyl)azanium.
| Compound Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7094282 |
| Molecular Formula | C20H36NO2+ |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(furan-2-ylmethyl)azanium |
| SMILES | CC(C)CC[C@H](CC[NH2+]Cc1ccco1)[C@@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C20H35NO2/c1-16(2)7-8-17(18-10-13-23-20(3,4)14-18)9-11-21-15-19-6-5-12-22-19/h5-6,12,16-18,21H,7-11,13-15H2,1-4H3/p+1/t17-,18-/m1/s1 |
| InChIKey | WOFHQFKMPWNEBG-QZTJIDSGSA-O |
| XLogP | 3.99 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|