C24H41NOS — CID 34253767
(3S)-N-[dimethylidene-(4-methylphenyl)-λ6-sulfanyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine (PubChem CID 34253767) has the molecular formula C24H41NOS and a molecular weight of 391.67 g/mol. Its IUPAC name is (3S)-N-[dimethylidene-(4-methylphenyl)-λ6-sulfanyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine.
| Compound Name | (3S)-N-[dimethylidene-(4-methylphenyl)-λ6-sulfanyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 34253767 |
| Molecular Formula | C24H41NOS |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | (3S)-N-[dimethylidene-(4-methylphenyl)-λ6-sulfanyl]-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptan-1-amine |
| SMILES | C=S(=C)(NCC[C@H](CCC(C)C)[C@@H]1CCOC(C)(C)C1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H41NOS/c1-19(2)8-11-21(22-15-17-26-24(4,5)18-22)14-16-25-27(6,7)23-12-9-20(3)10-13-23/h9-10,12-13,19,21-22,25H,6-8,11,14-18H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | XOUPDUPMPJGTEX-FCHUYYIVSA-N |
| XLogP | 6.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|