C24H40NO+ — CID 7094767
[(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-[(E)-3-phenylprop-2-enyl]azanium (PubChem CID 7094767) has the molecular formula C24H40NO+ and a molecular weight of 358.59 g/mol. Its IUPAC name is [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-[(E)-3-phenylprop-2-enyl]azanium.
| Compound Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-[(E)-3-phenylprop-2-enyl]azanium |
|---|---|
| PubChem CID | 7094767 |
| Molecular Formula | C24H40NO+ |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | [(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-[(E)-3-phenylprop-2-enyl]azanium |
| SMILES | CC(C)CC[C@H](CC[NH2+]C/C=C/c1ccccc1)[C@@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C24H39NO/c1-20(2)12-13-22(23-15-18-26-24(3,4)19-23)14-17-25-16-8-11-21-9-6-5-7-10-21/h5-11,20,22-23,25H,12-19H2,1-4H3/p+1/b11-8+/t22-,23-/m1/s1 |
| InChIKey | KVPNTTYXOXZHSK-MGVRZVOUSA-O |
| XLogP | 4.91 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|