About 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium
3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium (PubChem CID 7644088) has the molecular formula C21H38N2O+2
and a molecular weight of 334.55 g/mol. Its IUPAC name is 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium.
Molecular Properties
| Compound Name | 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium |
| PubChem CID | 7644088 |
| Molecular Formula | C21H38N2O+2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.30 |
| IUPAC Name | 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCC[NH2+]CC[C@H](c1ccccc1)[C@@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C21H36N2O/c1-21(2)17-19(12-16-24-21)20(18-9-6-5-7-10-18)11-14-22-13-8-15-23(3)4/h5-7,9-10,19-20,22H,8,11-17H2,1-4H3/p+2/t19-,20-/m1/s1 |
| InChIKey | GRUUTXSLUORAFV-WOJBJXKFSA-P |
| XLogP | 1.46 |
| TPSA | 30.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium?
The IUPAC name of 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium (CID 7644088) is 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium.
What is the SMILES notation for 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium?
The canonical SMILES for 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium is C[NH+](C)CCC[NH2+]CC[C@H](c1ccccc1)[C@@H]1CCOC(C)(C)C1.
What is the InChIKey of 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium?
The InChIKey is GRUUTXSLUORAFV-WOJBJXKFSA-P. The full InChI is InChI=1S/C21H36N2O/c1-21(2)17-19(12-16-24-21)20(18-9-6-5-7-10-18)11-14-22-13-8-15-23(3)4/h5-7,9-10,19-20,22H,8,11-17H2,1-4H3/p+2/t19-,20-/m1/s1.
What are the key properties of 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium?
3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium has a molecular weight of 334.55 g/mol, XLogP of 1.46, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-phenylpropyl]azaniumyl]propyl-dimethylazanium is sourced from PubChem (CID 7644088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).