C25H33NO2 — CID 2877801
N-benzyl-N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]acetamide (PubChem CID 2877801) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is N-benzyl-N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]acetamide.
| Compound Name | N-benzyl-N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 2877801 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | N-benzyl-N-[3-(2,2-dimethyloxan-4-yl)-3-phenylpropyl]acetamide |
| SMILES | CC(=O)N(CCC(c1ccccc1)C1CCOC(C)(C)C1)Cc1ccccc1 |
| InChI | InChI=1S/C25H33NO2/c1-20(27)26(19-21-10-6-4-7-11-21)16-14-24(22-12-8-5-9-13-22)23-15-17-28-25(2,3)18-23/h4-13,23-24H,14-19H2,1-3H3 |
| InChIKey | KLYJIWGORYQXPF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |