C28H40N2O3 — CID 1147460
N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)propyl]acetamide (PubChem CID 1147460) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)propyl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 1147460 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-3-(4-methoxyphenyl)propyl]acetamide |
| SMILES | COc1ccc([C@@H](CCN(Cc2ccc(N(C)C)cc2)C(C)=O)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C28H40N2O3/c1-21(31)30(20-22-7-11-25(12-8-22)29(4)5)17-15-27(23-9-13-26(32-6)14-10-23)24-16-18-33-28(2,3)19-24/h7-14,24,27H,15-20H2,1-6H3/t24-,27-/m1/s1 |
| InChIKey | XDQPEGIICKELSP-SHQCIBLASA-N |
| XLogP | 5.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|