C26H39N2O+ — CID 7069263
[4-(dimethylamino)phenyl]methyl-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]azanium (PubChem CID 7069263) has the molecular formula C26H39N2O+ and a molecular weight of 395.61 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]methyl-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]azanium.
| Compound Name | [4-(dimethylamino)phenyl]methyl-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]azanium |
|---|---|
| PubChem CID | 7069263 |
| Molecular Formula | C26H39N2O+ |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | [4-(dimethylamino)phenyl]methyl-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]azanium |
| SMILES | CN(C)c1ccc(C[NH2+]CC[C@H](Cc2ccccc2)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H38N2O/c1-26(2)19-24(15-17-29-26)23(18-21-8-6-5-7-9-21)14-16-27-20-22-10-12-25(13-11-22)28(3)4/h5-13,23-24,27H,14-20H2,1-4H3/p+1/t23-,24-/m1/s1 |
| InChIKey | BHBPSUYHNUDVJC-DNQXCXABSA-O |
| XLogP | 4.27 |
| TPSA | 29.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|