C22H29NO2S — CID 1427142
N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]thiophene-2-carboxamide (PubChem CID 1427142) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]thiophene-2-carboxamide.
| Compound Name | N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1427142 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]thiophene-2-carboxamide |
| SMILES | CC1(C)C[C@H]([C@H](CCNC(=O)c2cccs2)Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C22H29NO2S/c1-22(2)16-19(11-13-25-22)18(15-17-7-4-3-5-8-17)10-12-23-21(24)20-9-6-14-26-20/h3-9,14,18-19H,10-13,15-16H2,1-2H3,(H,23,24)/t18-,19-/m1/s1 |
| InChIKey | WJCLVGYMVXGTON-RTBURBONSA-N |
| XLogP | 4.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |