C26H36N2O — CID 7658688
4-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]iminomethyl]-N,N-dimethylaniline (PubChem CID 7658688) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is 4-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]iminomethyl]-N,N-dimethylaniline.
| Compound Name | 4-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]iminomethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 7658688 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 4-[[(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]iminomethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=N/CC[C@H](Cc2ccccc2)[C@@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H36N2O/c1-26(2)19-24(15-17-29-26)23(18-21-8-6-5-7-9-21)14-16-27-20-22-10-12-25(13-11-22)28(3)4/h5-13,20,23-24H,14-19H2,1-4H3/b27-20+/t23-,24-/m1/s1 |
| InChIKey | WLIRZHQCAMPRQX-KGSCEHNDSA-N |
| XLogP | 5.63 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|