C24H31NO3 — CID 4667607
2-[[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]iminomethyl]phenol (PubChem CID 4667607) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]iminomethyl]phenol.
| Compound Name | 2-[[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 4667607 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-[[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]iminomethyl]phenol |
| SMILES | COc1ccc(C(CC/N=C/c2ccccc2O)C2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-24(2)16-19(13-15-28-24)22(18-8-10-21(27-3)11-9-18)12-14-25-17-20-6-4-5-7-23(20)26/h4-11,17,19,22,26H,12-16H2,1-3H3/b25-17+ |
| InChIKey | MFJRMYNIXYXNOJ-KOEQRZSOSA-N |
| XLogP | 5.20 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|