C21H36N2O — CID 7641114
N-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 7641114) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is N-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 7641114 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | N-[(3S)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-phenylbutyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCC[C@H](Cc1ccccc1)[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C21H36N2O/c1-21(2)17-20(11-15-24-21)19(10-12-22-13-14-23(3)4)16-18-8-6-5-7-9-18/h5-9,19-20,22H,10-17H2,1-4H3/t19-,20+/m1/s1 |
| InChIKey | KRSFVMWBUGYVDM-UXHICEINSA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|