C22H36FNO — CID 7582478
(3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-N-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine (PubChem CID 7582478) has the molecular formula C22H36FNO and a molecular weight of 349.53 g/mol. Its IUPAC name is (3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-N-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine.
| Compound Name | (3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-N-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 7582478 |
| Molecular Formula | C22H36FNO |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | (3S)-3-[(4R)-2,2-dimethyloxan-4-yl]-N-[(4-fluorophenyl)methyl]-6-methylheptan-1-amine |
| SMILES | CC(C)CC[C@@H](CCNCc1ccc(F)cc1)[C@@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C22H36FNO/c1-17(2)5-8-19(20-12-14-25-22(3,4)15-20)11-13-24-16-18-6-9-21(23)10-7-18/h6-7,9-10,17,19-20,24H,5,8,11-16H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | GZOWTYROHMHWNF-VQTJNVASSA-N |
| XLogP | 5.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|