C20H35NOS — CID 4975210
3-(2,2-dimethyloxan-4-yl)-6-methyl-N-(thiophen-2-ylmethyl)heptan-1-amine (PubChem CID 4975210) has the molecular formula C20H35NOS and a molecular weight of 337.57 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-6-methyl-N-(thiophen-2-ylmethyl)heptan-1-amine.
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-6-methyl-N-(thiophen-2-ylmethyl)heptan-1-amine |
|---|---|
| PubChem CID | 4975210 |
| Molecular Formula | C20H35NOS |
| Molecular Weight | 337.57 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-6-methyl-N-(thiophen-2-ylmethyl)heptan-1-amine |
| SMILES | CC(C)CCC(CCNCc1cccs1)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C20H35NOS/c1-16(2)7-8-17(18-10-12-22-20(3,4)14-18)9-11-21-15-19-6-5-13-23-19/h5-6,13,16-18,21H,7-12,14-15H2,1-4H3 |
| InChIKey | ANGFVBLURPTQHP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|