C20H36NOS+ — CID 7554252
[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 7554252) has the molecular formula C20H36NOS+ and a molecular weight of 338.58 g/mol. Its IUPAC name is [(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7554252 |
| Molecular Formula | C20H36NOS+ |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-6-methylheptyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | CC(C)CC[C@H](CC[NH2+]Cc1cccs1)[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C20H35NOS/c1-16(2)7-8-17(18-10-12-22-20(3,4)14-18)9-11-21-15-19-6-5-13-23-19/h5-6,13,16-18,21H,7-12,14-15H2,1-4H3/p+1/t17-,18+/m1/s1 |
| InChIKey | ANGFVBLURPTQHP-MSOLQXFVSA-O |
| XLogP | 4.46 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|