C17H26NOS+ — CID 7623118
[(3S)-3-(furan-2-yl)-6-methylheptyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 7623118) has the molecular formula C17H26NOS+ and a molecular weight of 292.47 g/mol. Its IUPAC name is [(3S)-3-(furan-2-yl)-6-methylheptyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(3S)-3-(furan-2-yl)-6-methylheptyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7623118 |
| Molecular Formula | C17H26NOS+ |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(3S)-3-(furan-2-yl)-6-methylheptyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | CC(C)CC[C@@H](CC[NH2+]Cc1cccs1)c1ccco1 |
| InChI | InChI=1S/C17H25NOS/c1-14(2)7-8-15(17-6-3-11-19-17)9-10-18-13-16-5-4-12-20-16/h3-6,11-12,14-15,18H,7-10,13H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | NKKKVOUHYNVHPH-HNNXBMFYSA-O |
| XLogP | 4.01 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|