C22H34NO3+ — CID 7581729
(4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium (PubChem CID 7581729) has the molecular formula C22H34NO3+ and a molecular weight of 360.52 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium |
|---|---|
| PubChem CID | 7581729 |
| Molecular Formula | C22H34NO3+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium |
| SMILES | CCOc1ccc(C[NH2+]CC[C@@H](CCC(C)C)c2ccco2)cc1OC |
| InChI | InChI=1S/C22H33NO3/c1-5-25-21-11-9-18(15-22(21)24-4)16-23-13-12-19(10-8-17(2)3)20-7-6-14-26-20/h6-7,9,11,14-15,17,19,23H,5,8,10,12-13,16H2,1-4H3/p+1/t19-/m1/s1 |
| InChIKey | RKRQXBFYMCWNDK-LJQANCHMSA-O |
| XLogP | 4.36 |
| TPSA | 48.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|