C19H22NO3S+ — CID 7425090
[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(furan-2-ylmethyl)azanium (PubChem CID 7425090) has the molecular formula C19H22NO3S+ and a molecular weight of 344.46 g/mol. Its IUPAC name is [3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(furan-2-ylmethyl)azanium.
| Compound Name | [3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7425090 |
| Molecular Formula | C19H22NO3S+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-(furan-2-ylmethyl)azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2ccco2)ccc1OCc1cccs1 |
| InChI | InChI=1S/C19H21NO3S/c1-2-21-19-11-15(12-20-13-16-5-3-9-22-16)7-8-18(19)23-14-17-6-4-10-24-17/h3-11,20H,2,12-14H2,1H3/p+1 |
| InChIKey | PWEYTMTYLJRBOJ-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 48.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |