C17H22NO2S+ — CID 8621395
cyclopropyl-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium (PubChem CID 8621395) has the molecular formula C17H22NO2S+ and a molecular weight of 304.44 g/mol. Its IUPAC name is cyclopropyl-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium.
| Compound Name | cyclopropyl-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 8621395 |
| Molecular Formula | C17H22NO2S+ |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | cyclopropyl-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium |
| SMILES | CCOc1cc(C[NH2+]C2CC2)ccc1OCc1cccs1 |
| InChI | InChI=1S/C17H21NO2S/c1-2-19-17-10-13(11-18-14-6-7-14)5-8-16(17)20-12-15-4-3-9-21-15/h3-5,8-10,14,18H,2,6-7,11-12H2,1H3/p+1 |
| InChIKey | DVCZCAZHEPQZJM-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |