C17H24NO2S+ — CID 6965110
tert-butyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium (PubChem CID 6965110) has the molecular formula C17H24NO2S+ and a molecular weight of 306.45 g/mol. Its IUPAC name is tert-butyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium.
| Compound Name | tert-butyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 6965110 |
| Molecular Formula | C17H24NO2S+ |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | tert-butyl-[[3-methoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl]azanium |
| SMILES | COc1cc(C[NH2+]C(C)(C)C)ccc1OCc1cccs1 |
| InChI | InChI=1S/C17H23NO2S/c1-17(2,3)18-11-13-7-8-15(16(10-13)19-4)20-12-14-6-5-9-21-14/h5-10,18H,11-12H2,1-4H3/p+1 |
| InChIKey | IEDSMAHPXUMLJX-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |