C22H26NO3S+ — CID 7379837
[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-[(4-methoxyphenyl)methyl]azanium (PubChem CID 7379837) has the molecular formula C22H26NO3S+ and a molecular weight of 384.52 g/mol. Its IUPAC name is [3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-[(4-methoxyphenyl)methyl]azanium.
| Compound Name | [3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-[(4-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7379837 |
| Molecular Formula | C22H26NO3S+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methyl-[(4-methoxyphenyl)methyl]azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2ccc(OC)cc2)ccc1OCc1cccs1 |
| InChI | InChI=1S/C22H25NO3S/c1-3-25-22-13-18(8-11-21(22)26-16-20-5-4-12-27-20)15-23-14-17-6-9-19(24-2)10-7-17/h4-13,23H,3,14-16H2,1-2H3/p+1 |
| InChIKey | CRSLUYWIWXHSQM-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |