C16H22NO3+ — CID 7458290
(3,4-diethoxyphenyl)methyl-(furan-2-ylmethyl)azanium (PubChem CID 7458290) has the molecular formula C16H22NO3+ and a molecular weight of 276.36 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)methyl-(furan-2-ylmethyl)azanium.
| Compound Name | (3,4-diethoxyphenyl)methyl-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7458290 |
| Molecular Formula | C16H22NO3+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (3,4-diethoxyphenyl)methyl-(furan-2-ylmethyl)azanium |
| SMILES | CCOc1ccc(C[NH2+]Cc2ccco2)cc1OCC |
| InChI | InChI=1S/C16H21NO3/c1-3-18-15-8-7-13(10-16(15)19-4-2)11-17-12-14-6-5-9-20-14/h5-10,17H,3-4,11-12H2,1-2H3/p+1 |
| InChIKey | DWUDXMQLODICBH-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 48.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |