C17H23N2O2+ — CID 7449497
(3,4-diethoxyphenyl)methyl-(pyridin-2-ylmethyl)azanium (PubChem CID 7449497) has the molecular formula C17H23N2O2+ and a molecular weight of 287.38 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)methyl-(pyridin-2-ylmethyl)azanium.
| Compound Name | (3,4-diethoxyphenyl)methyl-(pyridin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7449497 |
| Molecular Formula | C17H23N2O2+ |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (3,4-diethoxyphenyl)methyl-(pyridin-2-ylmethyl)azanium |
| SMILES | CCOc1ccc(C[NH2+]Cc2ccccn2)cc1OCC |
| InChI | InChI=1S/C17H22N2O2/c1-3-20-16-9-8-14(11-17(16)21-4-2)12-18-13-15-7-5-6-10-19-15/h5-11,18H,3-4,12-13H2,1-2H3/p+1 |
| InChIKey | TZRXSGROTHCNSC-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |