C24H27ClNO2+ — CID 8635379
[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium (PubChem CID 8635379) has the molecular formula C24H27ClNO2+ and a molecular weight of 396.94 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium.
| Compound Name | [4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8635379 |
| Molecular Formula | C24H27ClNO2+ |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl-[(4-methylphenyl)methyl]azanium |
| SMILES | CCOc1cc(C[NH2+]Cc2ccc(C)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H26ClNO2/c1-3-27-24-14-21(16-26-15-19-6-4-18(2)5-7-19)10-13-23(24)28-17-20-8-11-22(25)12-9-20/h4-14,26H,3,15-17H2,1-2H3/p+1 |
| InChIKey | MUGQQQDAMGPQOC-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |