C22H25N2O2+ — CID 7228263
[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl-(pyridin-2-ylmethyl)azanium (PubChem CID 7228263) has the molecular formula C22H25N2O2+ and a molecular weight of 349.45 g/mol. Its IUPAC name is [3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl-(pyridin-2-ylmethyl)azanium.
| Compound Name | [3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl-(pyridin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7228263 |
| Molecular Formula | C22H25N2O2+ |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl-(pyridin-2-ylmethyl)azanium |
| SMILES | COc1cc(C[NH2+]Cc2ccccn2)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C22H24N2O2/c1-17-7-3-4-8-19(17)16-26-21-11-10-18(13-22(21)25-2)14-23-15-20-9-5-6-12-24-20/h3-13,23H,14-16H2,1-2H3/p+1 |
| InChIKey | DXEWNZDJRHXRRK-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |