C17H22NO3+ — CID 7458277
(3-ethoxy-4-prop-2-enoxyphenyl)methyl-(furan-2-ylmethyl)azanium (PubChem CID 7458277) has the molecular formula C17H22NO3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is (3-ethoxy-4-prop-2-enoxyphenyl)methyl-(furan-2-ylmethyl)azanium.
| Compound Name | (3-ethoxy-4-prop-2-enoxyphenyl)methyl-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7458277 |
| Molecular Formula | C17H22NO3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (3-ethoxy-4-prop-2-enoxyphenyl)methyl-(furan-2-ylmethyl)azanium |
| SMILES | C=CCOc1ccc(C[NH2+]Cc2ccco2)cc1OCC |
| InChI | InChI=1S/C17H21NO3/c1-3-9-21-16-8-7-14(11-17(16)19-4-2)12-18-13-15-6-5-10-20-15/h3,5-8,10-11,18H,1,4,9,12-13H2,2H3/p+1 |
| InChIKey | INWVAECVKFKCOG-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 48.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|