C25H23NO7 — CID 3396728
2-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 3396728) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 2-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3396728 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-(3-ethoxy-4-prop-2-enoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | C=CCOc1ccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2Cc2ccco2)cc1OCC |
| InChI | InChI=1S/C25H23NO7/c1-3-11-32-18-10-9-16(14-20(18)30-4-2)22-21(23(27)19-8-6-13-33-19)24(28)25(29)26(22)15-17-7-5-12-31-17/h3,5-10,12-14,22,28H,1,4,11,15H2,2H3 |
| InChIKey | FELAWBRKZJYZHG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|