C24H21NO6 — CID 7274668
(2R)-1-benzyl-2-(3-ethoxy-4-hydroxyphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 7274668) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is (2R)-1-benzyl-2-(3-ethoxy-4-hydroxyphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | (2R)-1-benzyl-2-(3-ethoxy-4-hydroxyphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 7274668 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R)-1-benzyl-2-(3-ethoxy-4-hydroxyphenyl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCOc1cc([C@@H]2C(C(=O)c3ccco3)=C(O)C(=O)N2Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C24H21NO6/c1-2-30-19-13-16(10-11-17(19)26)21-20(22(27)18-9-6-12-31-18)23(28)24(29)25(21)14-15-7-4-3-5-8-15/h3-13,21,26,28H,2,14H2,1H3/t21-/m1/s1 |
| InChIKey | GLGAOCHWYMMJHC-OAQYLSRUSA-N |
| XLogP | 4.16 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |