C25H25NO7 — CID 27308311
(2R)-2-(4-butoxy-3-methoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 27308311) has the molecular formula C25H25NO7 and a molecular weight of 451.48 g/mol. Its IUPAC name is (2R)-2-(4-butoxy-3-methoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | (2R)-2-(4-butoxy-3-methoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 27308311 |
| Molecular Formula | C25H25NO7 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (2R)-2-(4-butoxy-3-methoxyphenyl)-3-(furan-2-carbonyl)-1-(furan-2-ylmethyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc([C@@H]2C(C(=O)c3ccco3)=C(O)C(=O)N2Cc2ccco2)cc1OC |
| InChI | InChI=1S/C25H25NO7/c1-3-4-11-32-18-10-9-16(14-20(18)30-2)22-21(23(27)19-8-6-13-33-19)24(28)25(29)26(22)15-17-7-5-12-31-17/h5-10,12-14,22,28H,3-4,11,15H2,1-2H3/t22-/m1/s1 |
| InChIKey | VZMROGVHSMXOBB-JOCHJYFZSA-N |
| XLogP | 4.84 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|