C25H38NO3+ — CID 7714670
(4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(4-methoxyphenyl)-6-methylheptyl]azanium (PubChem CID 7714670) has the molecular formula C25H38NO3+ and a molecular weight of 400.58 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(4-methoxyphenyl)-6-methylheptyl]azanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(4-methoxyphenyl)-6-methylheptyl]azanium |
|---|---|
| PubChem CID | 7714670 |
| Molecular Formula | C25H38NO3+ |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-[(3R)-3-(4-methoxyphenyl)-6-methylheptyl]azanium |
| SMILES | CCOc1ccc(C[NH2+]CC[C@@H](CCC(C)C)c2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C25H37NO3/c1-6-29-24-14-8-20(17-25(24)28-5)18-26-16-15-22(9-7-19(2)3)21-10-12-23(27-4)13-11-21/h8,10-14,17,19,22,26H,6-7,9,15-16,18H2,1-5H3/p+1/t22-/m1/s1 |
| InChIKey | WQTJXHGKJLCVKM-JOCHJYFZSA-O |
| XLogP | 4.78 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|