C26H39NO3 — CID 7707299
(3R)-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine (PubChem CID 7707299) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is (3R)-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine.
| Compound Name | (3R)-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine |
|---|---|
| PubChem CID | 7707299 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | (3R)-N-[(3,4-dimethoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine |
| SMILES | COc1ccc(CNCC[C@@H](CCC(C)C)c2ccc(OC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C26H39NO3/c1-19(2)7-9-23(22-10-12-24(13-11-22)30-20(3)4)15-16-27-18-21-8-14-25(28-5)26(17-21)29-6/h8,10-14,17,19-20,23,27H,7,9,15-16,18H2,1-6H3/t23-/m1/s1 |
| InChIKey | DMCQEBYHMSYASW-HSZRJFAPSA-N |
| XLogP | 6.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|