C23H33NO2 — CID 3958867
3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-6-methylheptan-1-amine (PubChem CID 3958867) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-6-methylheptan-1-amine.
| Compound Name | 3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-6-methylheptan-1-amine |
|---|---|
| PubChem CID | 3958867 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-6-methylheptan-1-amine |
| SMILES | COc1ccc(CNCCC(CCC(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H33NO2/c1-18(2)5-8-21(20-9-13-23(26-4)14-10-20)15-16-24-17-19-6-11-22(25-3)12-7-19/h6-7,9-14,18,21,24H,5,8,15-17H2,1-4H3 |
| InChIKey | LUFXWMHKGCJJAY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|