C25H37NO2 — CID 7714620
(3R)-N-[(4-methoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine (PubChem CID 7714620) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (3R)-N-[(4-methoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine.
| Compound Name | (3R)-N-[(4-methoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine |
|---|---|
| PubChem CID | 7714620 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | (3R)-N-[(4-methoxyphenyl)methyl]-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine |
| SMILES | COc1ccc(CNCC[C@@H](CCC(C)C)c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H37NO2/c1-19(2)6-9-23(22-10-14-25(15-11-22)28-20(3)4)16-17-26-18-21-7-12-24(27-5)13-8-21/h7-8,10-15,19-20,23,26H,6,9,16-18H2,1-5H3/t23-/m1/s1 |
| InChIKey | YCVVIDRKQVJJKD-HSZRJFAPSA-N |
| XLogP | 6.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|