C25H27F2NO — CID 5032799
3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)propan-1-amine (PubChem CID 5032799) has the molecular formula C25H27F2NO and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)propan-1-amine.
| Compound Name | 3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 5032799 |
| Molecular Formula | C25H27F2NO |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(4-fluorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)propan-1-amine |
| SMILES | CC(C)Oc1ccc(C(CCNCc2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H27F2NO/c1-18(2)29-24-13-7-21(8-14-24)25(20-5-11-23(27)12-6-20)15-16-28-17-19-3-9-22(26)10-4-19/h3-14,18,25,28H,15-17H2,1-2H3 |
| InChIKey | PIESUQVPWCTSHG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|