C27H34FN2O+ — CID 2045301
[4-(dimethylamino)phenyl]methyl-[(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]azanium (PubChem CID 2045301) has the molecular formula C27H34FN2O+ and a molecular weight of 421.58 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]methyl-[(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]azanium.
| Compound Name | [4-(dimethylamino)phenyl]methyl-[(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]azanium |
|---|---|
| PubChem CID | 2045301 |
| Molecular Formula | C27H34FN2O+ |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | [4-(dimethylamino)phenyl]methyl-[(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]azanium |
| SMILES | CC(C)Oc1ccc([C@@H](CC[NH2+]Cc2ccc(N(C)C)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H33FN2O/c1-20(2)31-26-15-9-23(10-16-26)27(22-7-11-24(28)12-8-22)17-18-29-19-21-5-13-25(14-6-21)30(3)4/h5-16,20,27,29H,17-19H2,1-4H3/p+1/t27-/m0/s1 |
| InChIKey | MTOKEFKJIBORGF-MHZLTWQESA-O |
| XLogP | 4.96 |
| TPSA | 29.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|