C23H27FNO2+ — CID 7707305
[(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]-(furan-2-ylmethyl)azanium (PubChem CID 7707305) has the molecular formula C23H27FNO2+ and a molecular weight of 368.47 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]-(furan-2-ylmethyl)azanium.
| Compound Name | [(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7707305 |
| Molecular Formula | C23H27FNO2+ |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)-3-(4-propan-2-yloxyphenyl)propyl]-(furan-2-ylmethyl)azanium |
| SMILES | CC(C)Oc1ccc([C@@H](CC[NH2+]Cc2ccco2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H26FNO2/c1-17(2)27-21-11-7-19(8-12-21)23(18-5-9-20(24)10-6-18)13-14-25-16-22-4-3-15-26-22/h3-12,15,17,23,25H,13-14,16H2,1-2H3/p+1/t23-/m0/s1 |
| InChIKey | LCVKZCNJUUSFRD-QHCPKHFHSA-O |
| XLogP | 4.49 |
| TPSA | 38.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|