C24H35NO — CID 2048004
(3R)-N-benzyl-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine (PubChem CID 2048004) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is (3R)-N-benzyl-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine.
| Compound Name | (3R)-N-benzyl-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine |
|---|---|
| PubChem CID | 2048004 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (3R)-N-benzyl-6-methyl-3-(4-propan-2-yloxyphenyl)heptan-1-amine |
| SMILES | CC(C)CC[C@H](CCNCc1ccccc1)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C24H35NO/c1-19(2)10-11-23(16-17-25-18-21-8-6-5-7-9-21)22-12-14-24(15-13-22)26-20(3)4/h5-9,12-15,19-20,23,25H,10-11,16-18H2,1-4H3/t23-/m1/s1 |
| InChIKey | OTKKPECJIQHSHR-HSZRJFAPSA-N |
| XLogP | 6.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|