C21H32NO3+ — CID 7094102
(3,4-dimethoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium (PubChem CID 7094102) has the molecular formula C21H32NO3+ and a molecular weight of 346.49 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium |
|---|---|
| PubChem CID | 7094102 |
| Molecular Formula | C21H32NO3+ |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-[(3R)-3-(furan-2-yl)-6-methylheptyl]azanium |
| SMILES | COc1ccc(C[NH2+]CC[C@@H](CCC(C)C)c2ccco2)cc1OC |
| InChI | InChI=1S/C21H31NO3/c1-16(2)7-9-18(19-6-5-13-25-19)11-12-22-15-17-8-10-20(23-3)21(14-17)24-4/h5-6,8,10,13-14,16,18,22H,7,9,11-12,15H2,1-4H3/p+1/t18-/m1/s1 |
| InChIKey | NBBCJJMEMKWYAC-GOSISDBHSA-O |
| XLogP | 3.97 |
| TPSA | 48.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|