C12H18NO2+ — CID 2197774
(3,4-dimethoxyphenyl)methyl-prop-2-enylazanium (PubChem CID 2197774) has the molecular formula C12H18NO2+ and a molecular weight of 208.28 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-prop-2-enylazanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 2197774 |
| Molecular Formula | C12H18NO2+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-prop-2-enylazanium |
| SMILES | C=CC[NH2+]Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17NO2/c1-4-7-13-9-10-5-6-11(14-2)12(8-10)15-3/h4-6,8,13H,1,7,9H2,2-3H3/p+1 |
| InChIKey | PIZMGCOGYWPRMH-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|