C21H21ClN3O3+ — CID 7378086
[4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-methoxyphenyl]methyl-prop-2-enylazanium (PubChem CID 7378086) has the molecular formula C21H21ClN3O3+ and a molecular weight of 398.87 g/mol. Its IUPAC name is [4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-methoxyphenyl]methyl-prop-2-enylazanium.
| Compound Name | [4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-methoxyphenyl]methyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 7378086 |
| Molecular Formula | C21H21ClN3O3+ |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)oxy-3-methoxyphenyl]methyl-prop-2-enylazanium |
| SMILES | C=CC[NH2+]Cc1ccc(Oc2cnn(-c3ccccc3)c(=O)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-3-11-23-13-15-9-10-17(18(12-15)27-2)28-19-14-24-25(21(26)20(19)22)16-7-5-4-6-8-16/h3-10,12,14,23H,1,11,13H2,2H3/p+1 |
| InChIKey | YEKZWUUCORVJFY-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|